1-Hydroxysulfurmycin A | CAS No. | 79234-80-3 |
| Molecular Weight | 855.88 |
| Formula | C43H53NO17 |
| SMILES | O=C1C2=C(C(C3=C1C(O)=CC=C3O)=O)C(O)=C([C@H](C[C@@](CC(C)=O)([C@@H]4C(OC)=O)O)O[C@@H]5O[C@H]([C@H]([C@H](C5)N(C)C)O[C@@H]6O[C@H]([C@H]([C@H](C6)O)O[C@@H]7O[C@@H](C)C(CC7)=O)C)C)C4=C2 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22401 | Gaxilose | Inquiry |
|
| MDP-24064 | Nanaomycin B | Inquiry |
|
| MDP-12188 | Deoxylimonin | Inquiry |
|
| MDP-23673 | Methyl Lucidenate L | Inquiry |
|
| MDP-24025 | Panclicin B | Inquiry |
|
| MDP-22553 | Demethylmacrocin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
