1-O-Galloyl-2-O-cinnamoyl-glucose | CAS | 791836-69-6 |
| Molecular Weight | 462.40 |
| Formula | C22H22O11 |
| SMILES | O=C(C1=CC(O)=C(C(O)=C1)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)OC(/C=C/C3=CC=CC=C3)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16102 | Erysubin B | Inquiry |
|
| PDP-18440 | Hemiphroside B | Inquiry |
|
| PDP-16129 | Bryodulcosigenin | Inquiry |
|
| PDP-14535 | Djenkolic Acid | Inquiry |
|
| PDP-16768 | Notoginsenoside R4 | Inquiry |
|
| PDP-16514 | Corytuberine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
