12-Ketochenodeoxycholic Acid (Standard) | CAS No. | 2458-08-4 |
| Molecular Weight | 406.56 |
| Formula | C24H38O5 |
| SMILES | C[C@H](CCC(O)=O)[C@H]([C@]12C)CC[C@@]1([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC2=O |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23134 | 3β,15α-Dihydroxy-7,11,23-trioxo-lanost-8-dien-26-oic Acid | Inquiry |
|
| MDP-11712 | PSMα3 | Inquiry |
|
| MDP-22045 | Manumycin B | Inquiry |
|
| MDP-24280 | 4-Chlorothreonine | Inquiry |
|
| MDP-12660 | Herpotrichone B | Inquiry |
|
| MDP-11508 | Palmitoylglycine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
