12-Ketodeoxycholic Acid | CAS No. | 5130-29-0 |
| Purity | 99.81% |
| Synonyms | 12-Ketolithocholic Acid |
| Molecular Weight | 390.56 |
| Formula | C24H38O4 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | C[C@H](CCC(O)=O)[C@H]([C@]12C)CC[C@@]1([H])[C@]3([H])CC[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC2=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22535 | trans-2-Nonenal | Inquiry |
|
| MDP-22204 | Spinosyn A (Standard) | Inquiry |
|
| MDP-21986 | Sclerotiorin | Inquiry |
|
| MDP-21876 | Maduramicin | Inquiry |
|
| MDP-23446 | Arphamenine B | Inquiry |
|
| MDP-23960 | Mycoplanecin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
