1,2-O-Isopropylidene-3-O-Tosyla-D-Allofuranose
Catalog Number OM-5599
Product Name 1,2-O-Isopropylidene-3-O-Tosyla-D-Allofuranose
CAS No. 28251-83-4
| CAS No. | 28251-83-4 |
| Molecular Formula | C16H22O8S |
| MW | 374.41 |
| Boiling Point | 557.5±50.0ºC(lit.) |
| SMILES | O([CH]1[C]([H])(O[C]2([H])OC(C)(C)O[C]12[H])[CH](O)CO)S(C1C=CC(C)=CC=1)(=O)=O |
| InchiKey | YHCWPFMBKYICOM-UHFFFAOYSA-N |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5734 | 2-Deoxy-L-Erythro-Pentofuranose | Inquiry |
|
| OM-5414 | Beta-Cyclodextrin Hydrate | Inquiry |
|
| OM-5485 | Alpha-Lactose Monohydrate | Inquiry |
|
| OM-5708 | Sophorose | Inquiry |
|
| OM-5700 | Manninotriose | Inquiry |
|
| OM-5275 | Dextran T10 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.