1,2-O-Isopropylidene-Alpha-D-Allofuranose 
Catalog Number OM-5348
Product Name 1,2-O-Isopropylidene-Alpha-D-Allofuranose
CAS No. 4495-04-9
| CAS No. | 4495-04-9 |
| Molecular Formula | C9H16O6 |
| MW | 220.22 |
| MDL | MFCD07367509 |
| SMILES | [C]12([H])OC(C)(C)OC1O[C]([H])([CH](CO)O)[CH]2O |
| InchiKey | BGGCXQKYCBBHAH-UHFFFAOYSA-N |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5548 | 2,3,4-Tri-O-Acetyl-α-D-Xylopyranosyl Bromide | Inquiry |
|
| OM-5803 | 3-O-Methyl-Alpha-D-Glucopyranose | Inquiry |
|
| OM-5458 | L-Rhamnose | Inquiry |
|
| OM-5742 | L-Allose | Inquiry |
|
| OM-5482 | 1,6-Anhydro-Beta-D-Galactopyranose | Inquiry |
|
| OM-5486 | Arabinobiose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
