1,2:3,4-Di-O-Isopropylidene-6-Thio-A-D-Galactopyranose
Catalog Number OM-5580
Product Name 1,2:3,4-Di-O-Isopropylidene-6-Thio-A-D-Galactopyranose
CAS No. 16714-07-1
Size 1 g;
| CAS No. | 16714-07-1 |
| Molecular Formula | C12H20O5S |
| MW | 276.349 |
| Boiling Point | 347.4±37.0ºC(lit.) |
| Synonyms | 3,4-di-O-isopropylidene-6-thio-Α-D-galactopyranose |
| MDL | MFCD08448091 |
| SMILES | CC1(C)O[CH]2[CH]3OC(C)(C)O[CH]3O[CH](CS)[CH]2O1 |
| InchiKey | AGGBVTQMMNRHMZ-UHFFFAOYSA-N |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5293 | Mannan | Inquiry |
|
| OM-5439 | D(-)-Ribose | Inquiry |
|
| OM-5793 | Lactulose | Inquiry |
|
| OM-5444 | L-Arabitol | Inquiry |
|
| OM-5361 | D(+)-Trehalose Dihydrate | Inquiry |
|
| OM-5766 | L-Arabinose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.