1,2,3,4-Tetra-Ac: 1,2,3,4-Tetra-O-Acetyl-Beta-D-Mannopyranose 
Catalog Number OM-5355
Product Name 1,2,3,4-Tetra-Ac: 1,2,3,4-Tetra-O-Acetyl-Beta-D-Mannopyranose
CAS No. 28154-37-2
Size 1 g; 2g;
| CAS No. | 28154-37-2 |
| Molecular Formula | C14H20O10 |
| MW | 348.30 |
| Melting Point | 135.5ºC(lit.) |
| Boiling Point | 418.4±45.0ºC(lit.) |
| Synonyms | (2S,3S,4S,5R,6R)-6-(hydroxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetraacetic acid tetraethyl ester |
| MDL | MFCD12545782 |
| SMILES | CC(=O)OC1OC(CO)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InchiKey | FEQXFAYSNRWXDW-UHFFFAOYSA-N |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5382 | D(+)-Fucose | Inquiry |
|
| OM-5713 | 6-Amino-6-Deoxy-L-Sorbose | Inquiry |
|
| OM-5363 | D-(+)-Glucono-1,5-Lactone | Inquiry |
|
| OM-5289 | N-Acetyl-D-Glucosamine | Inquiry |
|
| OM-5458 | L-Rhamnose | Inquiry |
|
| OM-5494 | 1-Deoxy-1-(2-Hydroxyethylamino)-D-Glucitol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
