1,2,3,4-Tetra-O-Acetyl-6-Azido-6-Deoxy-D-Galactopyranose 
Catalog Number OM-5577
Product Name 1,2,3,4-Tetra-O-Acetyl-6-Azido-6-Deoxy-D-Galactopyranose
CAS No. 629620-22-0
| CAS No. | 629620-22-0 |
| Molecular Formula | C14H19N3O9 |
| MW | 373.32 |
| Synonyms | (2R,3S,4S,5R)-4,5,6-triacetoxy-2-(azidomethyl)oxan-3-yl]acetate |
| MDL | MFCD34181416 |
| SMILES | C1(OC(=O)C)O[CH](CN=[N+]=[N-])[CH](OC(=O)C)[CH](OC(=O)C)[CH]1OC(=O)C |
| InchiKey | LFQWTDKRDROWBN-UHFFFAOYSA-N |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5398 | D-Sorbitol | Inquiry |
|
| OM-5710 | D-(+)-Maltose Monohydrate | Inquiry |
|
| OM-5435 | (-)-2,3-O-Isopropylidene-D-Threitol | Inquiry |
|
| OM-5268 | Dextran T1 | Inquiry |
|
| OM-5579 | 1,2:3,4-Di-O-Isopropylidene-6-Deoxy-6-Nitro-A-D-Galactopyranose | Inquiry |
|
| OM-5323 | D-Xylitol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
