2-Desoxypleniradin-L-α-arabinopyranoside, 2-acetate | CAS | 97996-02-6 |
| Molecular Weight | 422.47 |
| Formula | C22H30O8 |
| SMILES | O=C1O[C@@H](CC2=C)[C@H](C[C@@]3([C@@]([H])2CC[C@]3(O[C@@H]4OC[C@@H]([C@@H]([C@H]4OC(C)=O)O)O)C)[H])C1=C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14090 | Fisetin (Standard) | Inquiry |
|
| PDP-18180 | Megastigm-7-ene-3,5,6,9-tetraol | Inquiry |
|
| PDP-14790 | Tetrahydropiperine | Inquiry |
|
| PDP-19831 | Macranthoidin B (Standard) | Inquiry |
|
| PDP-13232 | Hydroxytyrosol | Inquiry |
|
| PDP-19507 | T-Cadinol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
