2-(trans-1,4-Dihydroxy-cyclohexyl)-5,7-dihydroxy-chromone | CAS | 1270013-29-0 |
| Molecular Weight | 292.28 |
| Formula | C15H16O6 |
| SMILES | O=C1C2=C(O)C=C(O)C=C2OC([C@@]3(CC[C@@H](CC3)O)O)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15478 | Thymohydroquinone | Inquiry |
|
| PDP-17792 | Arachidin 2 | Inquiry |
|
| PDP-18999 | 3α-Hydroxytirucalla-7,24-dien-21-oic Acid | Inquiry |
|
| PDP-16101 | ε-Viniferin | Inquiry |
|
| PDP-19928 | Oroxylin A-7-O-glucuronide (Standard) | Inquiry |
|
| PDP-18080 | Broussonin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
