28-O-β-D-Glucopyranosyl Pomolic Acid | CAS | 83725-24-0 |
| Molecular Weight | 634.84 |
| Formula | C36H58O9 |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@@]3([H])CC=C4[C@]5([H])[C@](C)(O)[C@H](C)CC[C@@](C(O[C@H]6[C@@H]([C@H]([C@@H]([C@@H](CO)O6)O)O)O)=O)5CC[C@](C)4[C@@](C)3CC[C@@]12[H] |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20137 | Beta-Sitosterol (purity>98%) (Standard) | Inquiry |
|
| PDP-13134 | Irinotecan Hydrochloride | Inquiry |
|
| PDP-18832 | (-)-Isobicyclogermacrenal | Inquiry |
|
| PDP-19090 | Isopicropodophyllin | Inquiry |
|
| PDP-13599 | Deslanoside | Inquiry |
|
| PDP-19589 | Eupalinilide B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.