(2E)-Hexenoyl-CoA | CAS No. | 10018-93-6 |
| Synonyms | Hex-2-trans-enoyl-CoA |
| Molecular Weight | 863.66 |
| Formula | C27H44N7O17P3S |
| SMILES | NC1=NC=NC2=C1N=CN2[C@H]3[C@H](O)[C@H](OP(O)(O)=O)[C@@H](COP(O)(OP(O)(OCC(C)([C@H](C(NCCC(NCCSC(/C=C/CCC)=O)=O)=O)O)C)=O)=O)O3 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22436 | Grifolin (Standard) | Inquiry |
|
| MDP-11185 | Cinnamic Acid | Inquiry |
|
| MDP-23608 | Epoxyquinomicin B | Inquiry |
|
| MDP-23724 | Kynapcin-28 | Inquiry |
|
| MDP-11193 | Uridine 5'-monophosphate | Inquiry |
|
| MDP-23878 | Nemotin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
