(2S)-Isoxanthohumol | Appearance | Solid |
| CAS | 70872-29-6 |
| Purity | 99.42% |
| Molecular Weight | 354.40 |
| Formula | C21H22O5 |
| Color | Off-white to light yellow |
| SMILES | C/C(C)=C\CC1=C2C(C(C[C@@H](C3=CC=C(O)C=C3)O2)=O)=C(OC)C=C1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19161 | (+)-Hannokinol | Inquiry |
|
| PDP-13475 | Lentinan | Inquiry |
|
| PDP-15793 | 5-Hydroxy-3,7-dimethoxyflavone | Inquiry |
|
| PDP-15452 | Glucosinalbate | Inquiry |
|
| PDP-17624 | Leocarpinolide F | Inquiry |
|
| PDP-16077 | N-Benzyllinolenamide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
