3-Acetyldeoxynivalenol (Standard) | CAS No. | 50722-38-8 |
| Molecular Weight | 338.35 |
| Formula | C17H22O7 |
| SMILES | C[C@]1([C@@]([C@@H]2O)3CO)C[C@@H](OC(C)=O)[C@H]([C@@]14CO4)O[C@]3([H])C=C(C)C2=O |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-10944 | L-Glutathione Reduced | Inquiry |
|
| MDP-22719 | 2-Methylquinazolin-4-ol (Standard) | Inquiry |
|
| MDP-12249 | Inosine (Standard) | Inquiry |
|
| MDP-22580 | Antcin B | Inquiry |
|
| MDP-23865 | 5-Hydroxy-4-oxo-L-norvaline | Inquiry |
|
| MDP-11679 | Dimethyl Trisulfide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
