3α-Dihydrocadambine | CAS | 54483-84-0 |
| Molecular Weight | 546.57 |
| Formula | C27H34N2O10 |
| SMILES | O[C@@H]1CN2[C@](C[C@@](C(C(OC)=O)=CO3)([H])[C@]1([H])[C@@H]3O[C@@H]([C@@H]([C@H]4O)O)O[C@@H]([C@H]4O)CO)([H])C5=C(CC2)C6=CC=CC=C6N5 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19490 | Makisterone B | Inquiry |
|
| PDP-19747 | Momordin Ic (Standard) | Inquiry |
|
| PDP-14252 | Cirsilineol | Inquiry |
|
| PDP-13179 | Piperlongumine | Inquiry |
|
| PDP-15685 | Epimagnolin A | Inquiry |
|
| PDP-14413 | Panaxatriol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
