3-Hydroxyisovalerylcarnitine (Standard) | CAS No. | 99159-87-2 |
| Molecular Weight | 261.31 |
| Formula | C12H23NO5 |
| SMILES | CC(O)(CC(O[C@@H](C[N+](C)(C)C)CC([O-])=O)=O)C |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22739 | 1-Undecanol (Standard) | Inquiry |
|
| MDP-22984 | Lienomycin | Inquiry |
|
| MDP-12683 | Anserinone B | Inquiry |
|
| MDP-23886 | Scorodonin | Inquiry |
|
| MDP-22239 | Bostrycin | Inquiry |
|
| MDP-22307 | Peonidin (chloride) (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
