3'-Methoxyapiin | Synonyms | Graveobioside B; Chrysoeriol 7-O-apiosylglucoside |
| Appearance | Solid |
| CAS | 33579-63-4 |
| Purity | 99.78% |
| Molecular Weight | 594.52 |
| Formula | C27H30O15 |
| Color | Off-white to light yellow |
| SMILES | COC1=C(O)C=CC(C2=CC(C3=C(O)C=C(O[C@H]4[C@H](O[C@H]5[C@H](O)[C@](CO)(O)CO5)[C@@H](O)[C@H](O)[C@@H](CO)O4)C=C3O2)=O)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14667 | 10-Methoxycamptothecin | Inquiry |
|
| PDP-16435 | Cnicin | Inquiry |
|
| PDP-13408 | Halofuginone Hydrobromide | Inquiry |
|
| PDP-20554 | Isorhamnetin-3-O-neohespeidoside (Standard) | Inquiry |
|
| PDP-19504 | Baicalein Hydrate | Inquiry |
|
| PDP-17874 | Agarsenone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
