3-O-Methylducheside A | CAS | 62218-23-9 |
| Molecular Weight | 462.36 |
| Formula | C21H18O12 |
| SMILES | O=C1C2=CC(O[C@H]3[C@@H]([C@H]([C@@H](CO3)O)O)O)=C(OC)C(O4)=C2C5=C(C4=O)C=C(O)C(OC)=C5O1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16099 | Eleutheroside C | Inquiry |
|
| PDP-19677 | Quercetagetin (Standard) | Inquiry |
|
| PDP-15092 | (Rac)-Hesperetin | Inquiry |
|
| PDP-15654 | Physalin B | Inquiry |
|
| PDP-15160 | Vanillyl Butyl Ether | Inquiry |
|
| PDP-15332 | Larixol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
