3-Oxo-21α-methoxy-24,25,26,27-tetranortirucall-7-ene-23(21)-lactone | CAS | 1260173-73-6 |
| Molecular Weight | 428.60 |
| Formula | C27H40O4 |
| SMILES | C[C@@]12[C@]([C@@]([C@@](C3)([H])[C@@H](OC3=O)OC)([H])CC1)(CC[C@@]4([H])C2=CC[C@](C5(C)C)([H])[C@@]4(CCC5=O)C)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20372 | Scutebarbatine X | Inquiry |
|
| PDP-16502 | Ganoderic Acid C1 | Inquiry |
|
| PDP-15471 | Thaumatin B | Inquiry |
|
| PDP-18060 | Andrographiside | Inquiry |
|
| PDP-16235 | Regaloside H | Inquiry |
|
| PDP-17125 | Albaspidin AA | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
