3-Oxo-cinobufagin | CAS No. | 6869-66-5 |
| Molecular Weight | 440.53 |
| Formula | C26H32O6 |
| SMILES | C[C@]12[C@@]3([C@@]4([H])[C@]([C@@]5([C@](CC(CC5)=O)([H])CC4)C)([H])CC2)[C@]([C@@H]([C@@H]1C(C=C6)=COC6=O)OC(C)=O)([H])O3 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11785 | L-Allothreonine | Inquiry |
|
| MDP-12714 | Spiranthesol | Inquiry |
|
| MDP-12523 | Viridiol | Inquiry |
|
| MDP-22593 | Echinocandin B | Inquiry |
|
| MDP-23606 | Epopromycin B | Inquiry |
|
| MDP-11870 | 7-Methylguanine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
