3-tert-Butyl-4-methoxyphenol | Appearance | Solid |
| CAS | 88-32-4 |
| Purity | 99.69% |
| Molecular Weight | 180.24 |
| Formula | C11H16O2 |
| Color | Off-white to light brown |
| SMILES | OC1=CC=C(C(C(C)(C)C)=C1)OC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Store at room temperature 3 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19910 | Hosenkoside C (Standard) | Inquiry |
|
| PDP-14930 | Vanillin (Standard) | Inquiry |
|
| PDP-15773 | N-Benzoyl-(2R,3S)-3-phenylisoserine | Inquiry |
|
| PDP-19295 | Euphoscopin B | Inquiry |
|
| PDP-17050 | Laurycolactone A | Inquiry |
|
| PDP-14926 | Dihydroconiferyl Alcohol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
