3,29-Dibenzoyl Rarounitriol | Appearance | Solid |
| CAS | 873001-54-8 |
| Purity | 98.96% |
| Molecular Weight | 666.93 |
| Formula | C44H58O5 |
| Color | White to off-white |
| SMILES | O=C(C1=CC=CC=C1)OC[C@]2(C)CC[C@]([C@@]3([H])C2)(C)CC[C@]([C@@]3(C)CC4)(C)C5=C4[C@]6(C)[C@](C[C@@H]5O)([H])C(C)(C)[C@H](OC(C7=CC=CC=C7)=O)CC6 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15043 | 3',4',5',5,7-Pentamethoxyflavone | Inquiry |
|
| PDP-20195 | Arjungenin (Standard) | Inquiry |
|
| PDP-16919 | Capsiconiate | Inquiry |
|
| PDP-15664 | Ardisiacrispin B | Inquiry |
|
| PDP-18810 | Bancroftinone | Inquiry |
|
| PDP-17260 | (+)-trans-3'-Acetyl-4'-isobutyrylkhellactone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
