(3R,5R)-Octahydrocurcumin | Synonyms | (3R,5R)-Hexahydrobisdemethoxycurcumin |
| CAS | 408324-14-1 |
| Molecular Weight | 376.44 |
| Formula | C21H28O6 |
| SMILES | COC(C=C1CC[C@@H](O)C[C@H](O)CCC2=CC(OC)=C(C=C2)O)=C(C=C1)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18720 | Senecionine Acetate | Inquiry |
|
| PDP-14351 | 4-Allylcatechol | Inquiry |
|
| PDP-13469 | Berberine Chloride Hydrate | Inquiry |
|
| PDP-14034 | Galloylpaeoniflorin | Inquiry |
|
| PDP-19552 | (3R)-3',8-Dihydroxyvestitol | Inquiry |
|
| PDP-19026 | Kanshone B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
