4-Hydroxylonchocarpin | Appearance | Solid |
| CAS | 56083-03-5 |
| Purity | 99.28% |
| Molecular Weight | 322.36 |
| Formula | C20H18O4 |
| Color | Yellow to orange |
| SMILES | O=C(C1=CC=C2C(C=CC(C)(C)O2)=C1O)/C=C/C3=CC=C(O)C=C3 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15157 | Feruloylputrescine | Inquiry |
|
| PDP-13790 | Gambogenic Acid | Inquiry |
|
| PDP-17529 | Umuhengerin | Inquiry |
|
| PDP-15321 | Gardenin A | Inquiry |
|
| PDP-18765 | 7-Xylosyl-10-Deacetyltaxol B | Inquiry |
|
| PDP-18625 | Fructo-oligosaccharide DP11/GF10 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
