4-O-Galloylbergenin | CAS | 82958-45-0 |
| Molecular Weight | 480.38 |
| Formula | C21H20O13 |
| SMILES | O=C(O[C@H]1[C@H](O)[C@@H](CO)O[C@](C2=C(O)C(OC)=C(O)C=C23)([H])[C@]1([H])OC3=O)C4=CC(O)=C(O)C(O)=C4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15075 | Chrysosplenetin | Inquiry |
|
| PDP-18970 | Hydrangetin | Inquiry |
|
| PDP-20142 | Hederasaponin B (Standard) | Inquiry |
|
| PDP-14774 | Segetalin B | Inquiry |
|
| PDP-14342 | Pogostone | Inquiry |
|
| PDP-15774 | Macranthoidin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
