5-Deoxy-D-Arabinose | CAS No. | 67968-47-2 |
| Molecular Formula | C5H10O4 |
| MW | 134.131 |
| Synonyms | (2S,3R,4R)-2,3,4-trihydroxyvaleraldehyde |
| MDL | MFCD00038363 |
| SMILES | C[C@@H]1[C@H]([C@@H](C(O1)O)O)O |
| InchiKey | MKMRBXQLEMYZOY-ZRMNMSDTSA-N |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5816 | D-(+)-Cellotriose | Inquiry |
|
| OM-5284 | Dextran T200 | Inquiry |
|
| OM-5312 | 4-O-Benzyl-D-Glucal | Inquiry |
|
| OM-5336 | 2-Deoxy-Alpha-L-Erythro-Pentopyranose | Inquiry |
|
| OM-5380 | Sucralose | Inquiry |
|
| OM-5649 | 6-Chloro-6-Deoxyglucose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
