5-O-Cinnamoylquinic Acid | CAS | 5515-82-2 |
| Molecular Weight | 322.31 |
| Formula | C16H18O7 |
| SMILES | O=C(/C=C/C1=CC=CC=C1)O[C@H]2C[C@@](O)(C[C@@H]([C@H]2O)O)C(O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17427 | Strychnistenolide | Inquiry |
|
| PDP-19982 | DiosMetin 7-O-β-D-Glucuronide (Standard) | Inquiry |
|
| PDP-14774 | Segetalin B | Inquiry |
|
| PDP-18242 | Dugesin B | Inquiry |
|
| PDP-15419 | Mangiferin (Standard) | Inquiry |
|
| PDP-18201 | Lupeol Palmitate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
