5,7-Dimethoxyflavanone | Appearance | Solid |
| CAS | 1036-72-2 |
| Purity | 99.43% |
| Molecular Weight | 284.31 |
| Formula | C17H16O4 |
| Color | White to off-white |
| SMILES | O=C1CC(C2=CC=CC=C2)OC3=CC(OC)=CC(OC)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14870 | Aristolone | Inquiry |
|
| PDP-14499 | Taraxerol | Inquiry |
|
| PDP-17083 | Alloyohimbine | Inquiry |
|
| PDP-14385 | 5,7,3',4'-Tetramethoxyflavone | Inquiry |
|
| PDP-17337 | Neobritannilactone B | Inquiry |
|
| PDP-18593 | Rebaudioside N | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.