5Z-7-Oxozeaenol | CAS No. | 253863-19-3 |
| Purity | 99.60% |
| Synonyms | FR148083; L783279; LL-Z 1640-2 |
| Molecular Weight | 362.37 |
| Formula | C19H22O7 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O=C(O[C@@H](C)C/C=C\1)C2=C(O)C=C(OC)C=C2/C=C/C[C@H](O)[C@H](O)C1=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12007 | Chloramphenicol (Standard) | Inquiry |
|
| MDP-12756 | Ganoderenic Acid B | Inquiry |
|
| MDP-23655 | Atramycin A | Inquiry |
|
| MDP-22602 | Gentamicin C2 | Inquiry |
|
| MDP-22972 | Dactylfungin A | Inquiry |
|
| MDP-12479 | Aspochalasin M | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
