6"-O-Malonylgenistin | Synonyms | Malonylgenistin; Genistin Malonate |
| Appearance | Solid |
| CAS | 51011-05-3 |
| Purity | 99.24% |
| Molecular Weight | 518.42 |
| Formula | C24H22O13 |
| Color | White to light yellow |
| SMILES | O=C(C(C1=CC=C(O)C=C1)=COC2=CC(O[C@@H]([C@@H]([C@@H](O)[C@@H]3O)O)O[C@@H]3COC(CC(O)=O)=O)=C4)C2=C4O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17824 | Majoranaquinone | Inquiry |
|
| PDP-17419 | 8-Hydroxy-9-isobutyryloxy-10-(2-methylbutanoyl)thymol | Inquiry |
|
| PDP-16196 | 1-Dehydroxybaccatin IV | Inquiry |
|
| PDP-17550 | Celosin L | Inquiry |
|
| PDP-15908 | 2-Octyl-4(1H)-quinolone | Inquiry |
|
| PDP-20239 | Perilla Ketone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
