7-O-methylepimedonin G | CAS | 2220243-40-1 |
| Molecular Weight | 368.38 |
| Formula | C21H20O6 |
| SMILES | O=C1C=C(OC2=C(C/C=C(C)\C)C(OC)=CC(O)=C21)OC3=CC=C(C=C3)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18817 | Kushenol B | Inquiry |
|
| PDP-14211 | Licochalcone E | Inquiry |
|
| PDP-13651 | Solasodine | Inquiry |
|
| PDP-19175 | Procyanidin B2 3,3'-di-O-gallate | Inquiry |
|
| PDP-16522 | Jatrorrhizine | Inquiry |
|
| PDP-13930 | Tectoridin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
