7(R)-7,8-Dihydrosinomenine | CAS | 65494-41-9 |
| Molecular Weight | 331.41 |
| Formula | C19H25NO4 |
| SMILES | OC1=C2[C@]34[C@@](CC(C(C4)=O)OC)([H])[C@](N(CC3)C)([H])CC2=CC=C1OC |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14707 | Khasianine | Inquiry |
|
| PDP-18158 | Momordicoside G | Inquiry |
|
| PDP-20545 | Dehydroandrographolide (Standard) | Inquiry |
|
| PDP-13917 | Caraphenol A | Inquiry |
|
| PDP-20482 | Mollugin (Standard) | Inquiry |
|
| PDP-20368 | Glyurallin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
