8-Epidiosbulbin E Acetate | Synonyms | 8-Epidiosbulbin E Acetate |
| Appearance | Solid |
| CAS | 91095-48-6 |
| Purity | 98.42% |
| Molecular Weight | 388.41 |
| Formula | C21H24O7 |
| Color | Pale purple to purple |
| SMILES | CC(O[C@@H]1[C@@]([C@@](C(O2)=O)([H])C[C@@]2([H])C3)([H])[C@]3([H])[C@](C)(C[C@@H](C4=COC=C4)O5)[C@@](C5=O)([H])C1)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18358 | Erysotramidine | Inquiry |
|
| PDP-19471 | Vitexin Caffeate | Inquiry |
|
| PDP-14519 | α-Thujone | Inquiry |
|
| PDP-15354 | Laurolitsine Hydrochloride | Inquiry |
|
| PDP-20487 | Columbianadin (Standard) | Inquiry |
|
| PDP-20391 | Decursin (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
