8α-Tigloyloxyhirsutinolide 13-O-acetate | Synonyms | 8αTGH |
| CAS | 83182-58-5 |
| Molecular Weight | 420.45 |
| Formula | C22H28O8 |
| SMILES | O=C(/C(C)=C/C)O[C@@H](C[C@H]1C)C(/C(OC2=O)=C\[C@](O[C@]13O)(CC3)C)=C2COC(C)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19876 | Chebulagic Acid (Standard) | Inquiry |
|
| PDP-18788 | 6-Aldehydoisoophiopogonone B | Inquiry |
|
| PDP-13929 | Lawsone | Inquiry |
|
| PDP-15397 | Phenyl β-D-glucopyranoside | Inquiry |
|
| PDP-14603 | Sesamoside | Inquiry |
|
| PDP-16547 | cis-Emodin Bianthrone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
