9"-Methyl Salvianolate B | Appearance | Solid |
| CAS | 1167424-31-8 |
| Purity | 99.18% |
| Molecular Weight | 732.64 |
| Formula | C37H32O16 |
| Color | Off-white to light yellow |
| SMILES | OC1=C(O)C=CC(C[C@H](C(OC)=O)OC([C@H]2C3=C(/C=C/C(O[C@@H](C(O)=O)CC4=CC(O)=C(O)C=C4)=O)C=CC(O)=C3O[C@@H]2C5=CC(O)=C(O)C=C5)=O)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18930 | Atractylochromene | Inquiry |
|
| PDP-17041 | Neochamaejasmine A | Inquiry |
|
| PDP-13865 | Tormentic Acid | Inquiry |
|
| PDP-13131 | Baicalein | Inquiry |
|
| PDP-18331 | Dimeric Coniferyl Acetate | Inquiry |
|
| PDP-13819 | Eupalinolide B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
