9(S)-HpODE | CAS No. | 29774-12-7 |
| Purity | 98.0% |
| Synonyms | 9-D-Hydroperoxylinoleic Acid |
| Molecular Weight | 312.44 |
| Formula | C18H32O4 |
| Appearance | Liquid |
| Color | Colorless to light yellow |
| SMILES | CCCCC/C=C\C=C\[C@H](CCCCCCCC(O)=O)OO |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage | Solution, -20°C, 2 years |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12775 | α-L-Rhamnose | Inquiry |
|
| MDP-12674 | Monaschromone | Inquiry |
|
| MDP-12788 | Fumonisin B3 | Inquiry |
|
| MDP-11571 | Cyclo(L-Phe-L-Pro) | Inquiry |
|
| MDP-23752 | Epicochlioquinone A | Inquiry |
|
| MDP-12472 | TMC-205 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
