(9Z)-Antheraxanthin | CAS No. | 68831-78-7 |
| Molecular Weight | 584.87 |
| Formula | C40H56O3 |
| SMILES | CC1(C)C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)\C=C\[C@]23[C@](O2)(C[C@H](CC3(C)C)O)C)=C(C)C[C@@H](O)C1 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11851 | 2-Amino-2-deoxyglucose Hydrochloride | Inquiry |
|
| MDP-12572 | Thailanstatin C | Inquiry |
|
| MDP-12660 | Herpotrichone B | Inquiry |
|
| MDP-11187 | K-252a | Inquiry |
|
| MDP-12447 | Oxaline | Inquiry |
|
| MDP-23271 | Fluostatin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
