β-Acids Colupulone | CAS | 468-27-9 |
| Molecular Weight | 400.55 |
| Formula | C25H36O4 |
| SMILES | O=C1C(C/C=C(C)\C)=C(O)C(C(C(C)C)=O)=C(O)C1(C/C=C(C)\C)C/C=C(C)\C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14238 | Cyclen | Inquiry |
|
| PDP-17452 | Caulophyllumine A | Inquiry |
|
| PDP-16461 | Linustatin | Inquiry |
|
| PDP-14688 | Specneuzhenide | Inquiry |
|
| PDP-13822 | Eupalinolide A | Inquiry |
|
| PDP-17903 | Scutebarbatine B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
