Actinorhodin | CAS No. | 1397-77-9 |
| Molecular Weight | 634.54 |
| Formula | C32H26O14 |
| SMILES | O=C1C2=C(O)C(C3=CC(O)=C(C(C4=C([C@H](O[C@@H](C4)CC(O)=O)C)C5=O)=O)C5=C3O)=CC(O)=C2C(C6=C1[C@H](O[C@@H](C6)CC(O)=O)C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22150 | Ficellomycin | Inquiry |
|
| MDP-23189 | Salicylamide (Standard) | Inquiry |
|
| MDP-12660 | Herpotrichone B | Inquiry |
|
| MDP-23696 | Streptothricin E | Inquiry |
|
| MDP-10937 | Oligomycin | Inquiry |
|
| MDP-24338 | Homoalanosine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
