Actiphenol | CAS No. | 526-02-3 |
| Molecular Weight | 275.30 |
| Formula | C15H17NO4 |
| SMILES | O=C1NC(CC(CC(C2=C(O)C(C)=CC(C)=C2)=O)C1)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12166 | Mycaminosyltylonolide | Inquiry |
|
| MDP-22710 | 5-Aminovaleric Acid (Standard) | Inquiry |
|
| MDP-12444 | Avilamycin A | Inquiry |
|
| MDP-12477 | Oosponol | Inquiry |
|
| MDP-24256 | Cedarmycin B | Inquiry |
|
| MDP-22316 | Nonanal (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
