Adenosine 2',3'-cyclic Phosphate | CAS No. | 634-01-5 |
| Molecular Weight | 329.21 |
| Formula | C10H12N5O6P |
| SMILES | OC[C@@H]1[C@@H](OP2(O)=O)[C@@H](O2)[C@H](N3C(N=CN=C4N)=C4N=C3)O1 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22059 | Neoagarobiose | Inquiry |
|
| MDP-22251 | Sporidesmolide V | Inquiry |
|
| MDP-22018 | Maydispenoid B | Inquiry |
|
| MDP-24105 | 3-O-Demethyl-2'-N-glylfortimicin B | Inquiry |
|
| MDP-22940 | Prothracarcin | Inquiry |
|
| MDP-24279 | 6-O-Demethyl-5-deoxyfusarubin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
