·High-purity aerocyanidin suitable for research and industrial applications.
·Derived from natural sources, ensuring authenticity and reliability.
·Consistent quality and performance in various chemical and biological assays.
Aerocyanidin | CAS No. | 113701-99-8 |
| Molecular Weight | 283.36 |
| Formula | C15H25NO4 |
| SMILES | OC(CCCCCCCCC[C@H]([C@]1([H])[C@@](C)(O1)[N+]#[C-])O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
·High-purity aerocyanidin suitable for research and industrial applications.
·Derived from natural sources, ensuring authenticity and reliability.
·Consistent quality and performance in various chemical and biological assays.
·Antibiotic Properties: Effective against Gram-positive bacteria, with potential applications in pharmaceutical research.
·Versatility: Suitable for a variety of applications in biochemistry and microbiology.
·Stability: Maintains stability under proper storage conditions, ensuring long-term usability.
·Customizable: Available in various quantities and packaging options to meet specific needs.
·Pharmaceutical Research: Investigating the antibiotic properties and potential therapeutic applications.
·Biochemistry: Studying the mechanism of action and interactions with biological systems.
·Microbiology: Researching the effects on bacterial growth and resistance mechanisms.
·Environmental Science: Exploring the ecological impact and potential bioremediation applications.
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-21985 | Kagimminol B | Inquiry |
|
| MDP-21980 | Ganoderic Acid AM1 | Inquiry |
|
| MDP-23533 | Hericenone B | Inquiry |
|
| MDP-12624 | Petromurin C | Inquiry |
|
| MDP-21947 | N-(2-hydroxy-2-phenylethyl)acetamide | Inquiry |
|
| MDP-23523 | Arizonin C1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.