Aerugidiol | Appearance | Solid |
| CAS | 116425-35-5 |
| Purity | ≥99.0% |
| Molecular Weight | 250.33 |
| Formula | C15H22O3 |
| Color | White to off-white |
| SMILES | O[C@]12[C@]([C@@](CC2)(C)O)([H])C/C(C(C=C1C)=O)=C(C)\C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16141 | Kobusin | Inquiry |
|
| PDP-15685 | Epimagnolin A | Inquiry |
|
| PDP-13507 | (20S)-Protopanaxatriol | Inquiry |
|
| PDP-19907 | Hosenkoside K (Standard) | Inquiry |
|
| PDP-20439 | Tangeretin (Standard) | Inquiry |
|
| PDP-16876 | Isocudraniaxanthone B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
