Aflavarin | CAS No. | 144429-67-4 |
| Molecular Weight | 454.43 |
| Formula | C24H22O9 |
| SMILES | O=C1C(C2=C(C(C(OC)=C3)=C(C=C2OC)C)OC3=O)=C(C4=C(C=C(C=C4O1)OC)CO)OC |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-10954 | Spermidine | Inquiry |
|
| MDP-23543 | Celesticetin B | Inquiry |
|
| MDP-24165 | Pelagiomicin C | Inquiry |
|
| MDP-11468 | Cysteinylglycine | Inquiry |
|
| MDP-11181 | Kuromanin Chloride | Inquiry |
|
| MDP-12763 | Isomedicarpin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
