Afzelin (Standard) | Appearance | Solid |
| CAS | 482-39-3 |
| Molecular Weight | 432.38 |
| Formula | C₂₁H₂₀O₁₀ |
| Color | Light yellow to yellow |
| SMILES | O=C1C(O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)=C(C3=CC=C(O)C=C3)OC4=CC(O)=CC(O)=C14 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18539 | Chimonanthine | Inquiry |
|
| PDP-13930 | Tectoridin | Inquiry |
|
| PDP-18406 | Goniotriol | Inquiry |
|
| PDP-14838 | Ginsenoside F4 | Inquiry |
|
| PDP-18765 | 7-Xylosyl-10-Deacetyltaxol B | Inquiry |
|
| PDP-19700 | Hydrocotoin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
