Aglain C | Synonyms | (-)-Aglain C |
| CAS | 177468-85-8 |
| Molecular Weight | 630.73 |
| Formula | C36H42N2O8 |
| SMILES | OC1[C@@](OC2=CC(OC)=CC(OC)=C2[C@]13O)(C(C=C4)=CC=C4OC)[C@H](C5=CC=CC=C5)[C@H]3C(N(CCC6)[C@@H]6NC([C@@H](C)CC)=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18382 | Furomollugin | Inquiry |
|
| PDP-18502 | Jasminoside B | Inquiry |
|
| PDP-16105 | Glabranine | Inquiry |
|
| PDP-14544 | Racanisodamine | Inquiry |
|
| PDP-18500 | Lotusine | Inquiry |
|
| PDP-13164 | Salvianolic Acid B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
