Ajmalicine | Synonyms | Raubasine |
| Appearance | Solid |
| CAS | 483-04-5 |
| Purity | 99.39% |
| Molecular Weight | 352.43 |
| Formula | C21H24N2O3 |
| Color | Off-white to light yellow |
| SMILES | O=C(C1=CO[C@@H](C)[C@](CN2CC3)([H])[C@]1([H])C[C@@]2([H])C4=C3C5=CC=CC=C5N4)OC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20390 | Gossypol (acetic Acid) (Standard) | Inquiry |
|
| PDP-20042 | α-Chaconine (Standard) | Inquiry |
|
| PDP-17796 | Sibiricine | Inquiry |
|
| PDP-18197 | Lycoclavanol | Inquiry |
|
| PDP-19195 | Quercetin 7-O-rutinoside | Inquiry |
|
| PDP-14083 | Neriifolin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
