Alantolactone (Standard) | CAS | 546-43-0 |
| Molecular Weight | 232.32 |
| Formula | C15H20O2 |
| SMILES | O=C(O[C@@]1([H])[C@]2([H])C=C3[C@@H](C)CCC[C@]3(C)C1)C2=C |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19764 | 5-O-Methylvisammioside (Standard) | Inquiry |
|
| PDP-17553 | Aconicarchamine B | Inquiry |
|
| PDP-16184 | Aleuritic Acid | Inquiry |
|
| PDP-19704 | 6-epi-8-O-Acetylharpagide | Inquiry |
|
| PDP-18351 | Epicatechin Pentaacetate | Inquiry |
|
| PDP-17502 | Tremulacin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
