All-trans-retinal | CAS No. | 116-31-4 |
| Purity | 99.76% |
| Molecular Weight | 284.44 |
| Formula | C20H28O |
| Appearance | Solid |
| Color | Light yellow to yellow |
| SMILES | CC(/C=C/C=C(/C=C/C1=C(CCCC(C)1C)C)C)=C\C=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
-20°C, protect from light, stored under nitrogen The compound is unstable in solutions, freshly prepared is recommended. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11403 | Oxytetracycline | Inquiry |
|
| MDP-23798 | Salfredin C2 | Inquiry |
|
| MDP-12766 | Enniatin B | Inquiry |
|
| MDP-24214 | Saframycin H | Inquiry |
|
| MDP-22274 | Methyl 20(21)-dehydrolucidenate A | Inquiry |
|
| MDP-11224 | Apicidin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
